C16H34O4Si — CID 10663386
triethyl-[(2S,3S,4S)-3-methoxy-4-(methoxymethoxy)-2-methylhex-5-enoxy]silane (PubChem CID 10663386) has the molecular formula C16H34O4Si and a molecular weight of 318.53 g/mol. Its IUPAC name is triethyl-[(2S,3S,4S)-3-methoxy-4-(methoxymethoxy)-2-methylhex-5-enoxy]silane.
| Compound Name | triethyl-[(2S,3S,4S)-3-methoxy-4-(methoxymethoxy)-2-methylhex-5-enoxy]silane |
|---|---|
| PubChem CID | 10663386 |
| Molecular Formula | C16H34O4Si |
| Molecular Weight | 318.53 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | triethyl-[(2S,3S,4S)-3-methoxy-4-(methoxymethoxy)-2-methylhex-5-enoxy]silane |
| SMILES | C=C[C@H](OCOC)[C@@H](OC)[C@@H](C)CO[Si](CC)(CC)CC |
| InChI | InChI=1S/C16H34O4Si/c1-8-15(19-13-17-6)16(18-7)14(5)12-20-21(9-2,10-3)11-4/h8,14-16H,1,9-13H2,2-7H3/t14-,15-,16-/m0/s1 |
| InChIKey | ABPWONZIIUAKBP-JYJNAYRXSA-N |
| XLogP | 3.83 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.53 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|