C20H44O4Si2 — CID 11486539
tert-butyl-[(2R,3S)-4-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-2-methylpent-4-enoxy]-dimethylsilane (PubChem CID 11486539) has the molecular formula C20H44O4Si2 and a molecular weight of 404.74 g/mol. Its IUPAC name is tert-butyl-[(2R,3S)-4-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-2-methylpent-4-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2R,3S)-4-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-2-methylpent-4-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11486539 |
| Molecular Formula | C20H44O4Si2 |
| Molecular Weight | 404.74 g/mol |
| Exact Mass | 404.28 |
| IUPAC Name | tert-butyl-[(2R,3S)-4-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-2-methylpent-4-enoxy]-dimethylsilane |
| SMILES | C=C(O[Si](C)(C)C(C)(C)C)[C@@H](OCOC)[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H44O4Si2/c1-16(14-23-25(10,11)19(3,4)5)18(22-15-21-9)17(2)24-26(12,13)20(6,7)8/h16,18H,2,14-15H2,1,3-13H3/t16-,18+/m1/s1 |
| InChIKey | ZHBPPPZZYLKUTP-AEFFLSMTSA-N |
| XLogP | 6.17 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.74 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|