C20H44O4Si2 — CID 11784470
(3S,4S)-1-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4-(2-trimethylsilylethoxymethoxy)hex-5-en-3-ol (PubChem CID 11784470) has the molecular formula C20H44O4Si2 and a molecular weight of 404.74 g/mol. Its IUPAC name is (3S,4S)-1-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4-(2-trimethylsilylethoxymethoxy)hex-5-en-3-ol.
| Compound Name | (3S,4S)-1-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4-(2-trimethylsilylethoxymethoxy)hex-5-en-3-ol |
|---|---|
| PubChem CID | 11784470 |
| Molecular Formula | C20H44O4Si2 |
| Molecular Weight | 404.74 g/mol |
| Exact Mass | 404.28 |
| IUPAC Name | (3S,4S)-1-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4-(2-trimethylsilylethoxymethoxy)hex-5-en-3-ol |
| SMILES | C=C[C@H](OCOCC[Si](C)(C)C)[C@@H](O)C(C)(C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H44O4Si2/c1-12-17(23-16-22-13-14-25(7,8)9)18(21)20(5,6)15-24-26(10,11)19(2,3)4/h12,17-18,21H,1,13-16H2,2-11H3/t17-,18+/m0/s1 |
| InChIKey | HOAVPSDJRKXZCQ-ZWKOTPCHSA-N |
| XLogP | 5.28 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.74 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|