C15H32O4Si — CID 10756934
(2S,3R,4R)-1-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)-2-methylhex-5-en-3-ol (PubChem CID 10756934) has the molecular formula C15H32O4Si and a molecular weight of 304.50 g/mol. Its IUPAC name is (2S,3R,4R)-1-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)-2-methylhex-5-en-3-ol.
| Compound Name | (2S,3R,4R)-1-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)-2-methylhex-5-en-3-ol |
|---|---|
| PubChem CID | 10756934 |
| Molecular Formula | C15H32O4Si |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.21 |
| IUPAC Name | (2S,3R,4R)-1-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)-2-methylhex-5-en-3-ol |
| SMILES | C=C[C@@H](OCOC)[C@H](O)[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H32O4Si/c1-9-13(18-11-17-6)14(16)12(2)10-19-20(7,8)15(3,4)5/h9,12-14,16H,1,10-11H2,2-8H3/t12-,13+,14+/m0/s1 |
| InChIKey | YLOZWUGZGWWFGS-BFHYXJOUSA-N |
| XLogP | 3.18 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|