C18H36O6Si — CID 164606420
(4S,5R)-2,2-ditert-butyl-5-(methoxymethoxy)-4-[(1R)-1-(methoxymethoxy)prop-2-enyl]-1,3,2-dioxasilinane (PubChem CID 164606420) has the molecular formula C18H36O6Si and a molecular weight of 376.57 g/mol. Its IUPAC name is (4S,5R)-2,2-ditert-butyl-5-(methoxymethoxy)-4-[(1R)-1-(methoxymethoxy)prop-2-enyl]-1,3,2-dioxasilinane.
| Compound Name | (4S,5R)-2,2-ditert-butyl-5-(methoxymethoxy)-4-[(1R)-1-(methoxymethoxy)prop-2-enyl]-1,3,2-dioxasilinane |
|---|---|
| PubChem CID | 164606420 |
| Molecular Formula | C18H36O6Si |
| Molecular Weight | 376.57 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | (4S,5R)-2,2-ditert-butyl-5-(methoxymethoxy)-4-[(1R)-1-(methoxymethoxy)prop-2-enyl]-1,3,2-dioxasilinane |
| SMILES | C=C[C@@H](OCOC)[C@@H]1O[Si](C(C)(C)C)(C(C)(C)C)OC[C@H]1OCOC |
| InChI | InChI=1S/C18H36O6Si/c1-10-14(21-12-19-8)16-15(22-13-20-9)11-23-25(24-16,17(2,3)4)18(5,6)7/h10,14-16H,1,11-13H2,2-9H3/t14-,15-,16+/m1/s1 |
| InChIKey | ZSTJFVUSXXXYNX-OAGGEKHMSA-N |
| XLogP | 3.61 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.57 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|