C16H32O6Si — CID 50901696
[(2R,3S,4R)-3,4-bis(methoxymethoxy)-3,4-dihydro-2H-pyran-2-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 50901696) has the molecular formula C16H32O6Si and a molecular weight of 348.51 g/mol. Its IUPAC name is [(2R,3S,4R)-3,4-bis(methoxymethoxy)-3,4-dihydro-2H-pyran-2-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,3S,4R)-3,4-bis(methoxymethoxy)-3,4-dihydro-2H-pyran-2-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 50901696 |
| Molecular Formula | C16H32O6Si |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | [(2R,3S,4R)-3,4-bis(methoxymethoxy)-3,4-dihydro-2H-pyran-2-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | COCO[C@H]1[C@H](OCOC)C=CO[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H32O6Si/c1-16(2,3)23(6,7)22-10-14-15(21-12-18-5)13(8-9-19-14)20-11-17-4/h8-9,13-15H,10-12H2,1-7H3/t13-,14-,15+/m1/s1 |
| InChIKey | DROQTCPLSRFANU-KFWWJZLASA-N |
| XLogP | 2.90 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|