C38H80O5Si2Sn — CID 134882794
[(2R,3S,4R)-3-(methoxymethoxy)-6-tributylstannyl-4-tri(propan-2-yl)silyloxy-3,4-dihydro-2H-pyran-2-yl]methoxy-tri(propan-2-yl)silane (PubChem CID 134882794) has the molecular formula C38H80O5Si2Sn and a molecular weight of 791.94 g/mol. Its IUPAC name is [(2R,3S,4R)-3-(methoxymethoxy)-6-tributylstannyl-4-tri(propan-2-yl)silyloxy-3,4-dihydro-2H-pyran-2-yl]methoxy-tri(propan-2-yl)silane.
| Compound Name | [(2R,3S,4R)-3-(methoxymethoxy)-6-tributylstannyl-4-tri(propan-2-yl)silyloxy-3,4-dihydro-2H-pyran-2-yl]methoxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 134882794 |
| Molecular Formula | C38H80O5Si2Sn |
| Molecular Weight | 791.94 g/mol |
| Exact Mass | 792.46 |
| IUPAC Name | [(2R,3S,4R)-3-(methoxymethoxy)-6-tributylstannyl-4-tri(propan-2-yl)silyloxy-3,4-dihydro-2H-pyran-2-yl]methoxy-tri(propan-2-yl)silane |
| SMILES | CCCC[Sn](CCCC)(CCCC)C1=C[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](OCOC)[C@@H](CO[Si](C(C)C)(C(C)C)C(C)C)O1 |
| InChI | InChI=1S/C26H53O5Si2.3C4H9.Sn/c1-18(2)32(19(3)4,20(5)6)30-16-25-26(29-17-27-13)24(14-15-28-25)31-33(21(7)8,22(9)10)23(11)12;3*1-3-4-2;/h14,18-26H,16-17H2,1-13H3;3*1,3-4H2,2H3;/t24-,25-,26-;;;;/m1..../s1 |
| InChIKey | ZXBQWOYVZJOECO-IIOWEFHHSA-N |
| XLogP | 12.40 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.94 |
| LogP ≤ 5 | 12.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|