C39H84O4Si3Sn — CID 134974922
[(2R,3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-tributylstannyl-3,4-dihydro-2H-pyran-2-yl]methoxy-tri(propan-2-yl)silane (PubChem CID 134974922) has the molecular formula C39H84O4Si3Sn and a molecular weight of 820.07 g/mol. Its IUPAC name is [(2R,3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-tributylstannyl-3,4-dihydro-2H-pyran-2-yl]methoxy-tri(propan-2-yl)silane.
| Compound Name | [(2R,3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-tributylstannyl-3,4-dihydro-2H-pyran-2-yl]methoxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 134974922 |
| Molecular Formula | C39H84O4Si3Sn |
| Molecular Weight | 820.07 g/mol |
| Exact Mass | 820.47 |
| IUPAC Name | [(2R,3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-tributylstannyl-3,4-dihydro-2H-pyran-2-yl]methoxy-tri(propan-2-yl)silane |
| SMILES | CCCC[Sn](CCCC)(CCCC)C1=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C(C)C)(C(C)C)C(C)C)O1 |
| InChI | InChI=1S/C27H57O4Si3.3C4H9.Sn/c1-20(2)34(21(3)4,22(5)6)29-19-24-25(31-33(15,16)27(10,11)12)23(17-18-28-24)30-32(13,14)26(7,8)9;3*1-3-4-2;/h17,20-25H,19H2,1-16H3;3*1,3-4H2,2H3;/t23-,24-,25-;;;;/m1..../s1 |
| InChIKey | DRBPPJUMQJUSKR-QAQIZZNUSA-N |
| XLogP | 13.63 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.07 |
| LogP ≤ 5 | 13.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|