C23H28ClN5O2 — CID 111412564
4-chloro-N-[2-[[N-ethyl-N'-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]carbamimidoyl]amino]ethyl]benzamide (PubChem CID 111412564) has the molecular formula C23H28ClN5O2 and a molecular weight of 441.96 g/mol. Its IUPAC name is 4-chloro-N-[2-[[N-ethyl-N'-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]carbamimidoyl]amino]ethyl]benzamide.
| Compound Name | 4-chloro-N-[2-[[N-ethyl-N'-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]carbamimidoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 111412564 |
| Molecular Formula | C23H28ClN5O2 |
| Molecular Weight | 441.96 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 4-chloro-N-[2-[[N-ethyl-N'-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]carbamimidoyl]amino]ethyl]benzamide |
| SMILES | CCN/C(=N\Cc1ccc(N2CCCC2=O)cc1)NCCNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H28ClN5O2/c1-2-25-23(27-14-13-26-22(31)18-7-9-19(24)10-8-18)28-16-17-5-11-20(12-6-17)29-15-3-4-21(29)30/h5-12H,2-4,13-16H2,1H3,(H,26,31)(H2,25,27,28) |
| InChIKey | AWLNFAJIPLFEDI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.96 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|