C19H23BrN4OS — CID 111412648
1-[(5-bromothiophen-2-yl)methyl]-3-ethyl-2-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine (PubChem CID 111412648) has the molecular formula C19H23BrN4OS and a molecular weight of 435.39 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)methyl]-3-ethyl-2-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine.
| Compound Name | 1-[(5-bromothiophen-2-yl)methyl]-3-ethyl-2-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111412648 |
| Molecular Formula | C19H23BrN4OS |
| Molecular Weight | 435.39 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)methyl]-3-ethyl-2-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(N2CCCC2=O)cc1)NCc1ccc(Br)s1 |
| InChI | InChI=1S/C19H23BrN4OS/c1-2-21-19(23-13-16-9-10-17(20)26-16)22-12-14-5-7-15(8-6-14)24-11-3-4-18(24)25/h5-10H,2-4,11-13H2,1H3,(H2,21,22,23) |
| InChIKey | LSRLQIFNUOIXKO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|