C27H38IN5O — CID 111414525
1,2-dimethyl-3-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-1-[(4-piperidin-1-ylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111414525) has the molecular formula C27H38IN5O and a molecular weight of 575.54 g/mol. Its IUPAC name is 1,2-dimethyl-3-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-1-[(4-piperidin-1-ylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1,2-dimethyl-3-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-1-[(4-piperidin-1-ylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111414525 |
| Molecular Formula | C27H38IN5O |
| Molecular Weight | 575.54 g/mol |
| Exact Mass | 575.21 |
| IUPAC Name | 1,2-dimethyl-3-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-1-[(4-piperidin-1-ylphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cccc(CN2CCCC2=O)c1)N(C)Cc1ccc(N2CCCCC2)cc1.I |
| InChI | InChI=1S/C27H37N5O.HI/c1-28-27(29-19-23-8-6-9-24(18-23)21-32-17-7-10-26(32)33)30(2)20-22-11-13-25(14-12-22)31-15-4-3-5-16-31;/h6,8-9,11-14,18H,3-5,7,10,15-17,19-21H2,1-2H3,(H,28,29);1H |
| InChIKey | NOGYEKWKDAWTIN-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.54 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|