C22H28ClIN4O — CID 111294598
1-[(2-chlorophenyl)methyl]-1,2-dimethyl-3-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide (PubChem CID 111294598) has the molecular formula C22H28ClIN4O and a molecular weight of 526.85 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-1,2-dimethyl-3-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[(2-chlorophenyl)methyl]-1,2-dimethyl-3-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111294598 |
| Molecular Formula | C22H28ClIN4O |
| Molecular Weight | 526.85 g/mol |
| Exact Mass | 526.10 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-1,2-dimethyl-3-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(CN2CCCC2=O)c1)N(C)Cc1ccccc1Cl.I |
| InChI | InChI=1S/C22H27ClN4O.HI/c1-24-22(26(2)16-19-9-3-4-10-20(19)23)25-14-17-7-5-8-18(13-17)15-27-12-6-11-21(27)28;/h3-5,7-10,13H,6,11-12,14-16H2,1-2H3,(H,24,25);1H |
| InChIKey | CBIFBUAXQBYQFA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.85 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|