C20H35IN4O3 — CID 111415140
1-ethyl-3-(2-piperidin-1-ylethyl)-2-[(2,4,6-trimethoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111415140) has the molecular formula C20H35IN4O3 and a molecular weight of 506.43 g/mol. Its IUPAC name is 1-ethyl-3-(2-piperidin-1-ylethyl)-2-[(2,4,6-trimethoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(2-piperidin-1-ylethyl)-2-[(2,4,6-trimethoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111415140 |
| Molecular Formula | C20H35IN4O3 |
| Molecular Weight | 506.43 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | 1-ethyl-3-(2-piperidin-1-ylethyl)-2-[(2,4,6-trimethoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1c(OC)cc(OC)cc1OC)NCCN1CCCCC1.I |
| InChI | InChI=1S/C20H34N4O3.HI/c1-5-21-20(22-9-12-24-10-7-6-8-11-24)23-15-17-18(26-3)13-16(25-2)14-19(17)27-4;/h13-14H,5-12,15H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | WOZFQACKXNYHNS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.43 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|