C18H29FN4O — CID 111416087
1-ethyl-2-[(3-fluoro-4-methoxyphenyl)methyl]-3-(2-piperidin-1-ylethyl)guanidine (PubChem CID 111416087) has the molecular formula C18H29FN4O and a molecular weight of 336.45 g/mol. Its IUPAC name is 1-ethyl-2-[(3-fluoro-4-methoxyphenyl)methyl]-3-(2-piperidin-1-ylethyl)guanidine.
| Compound Name | 1-ethyl-2-[(3-fluoro-4-methoxyphenyl)methyl]-3-(2-piperidin-1-ylethyl)guanidine |
|---|---|
| PubChem CID | 111416087 |
| Molecular Formula | C18H29FN4O |
| Molecular Weight | 336.45 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | 1-ethyl-2-[(3-fluoro-4-methoxyphenyl)methyl]-3-(2-piperidin-1-ylethyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(F)c1)NCCN1CCCCC1 |
| InChI | InChI=1S/C18H29FN4O/c1-3-20-18(21-9-12-23-10-5-4-6-11-23)22-14-15-7-8-17(24-2)16(19)13-15/h7-8,13H,3-6,9-12,14H2,1-2H3,(H2,20,21,22) |
| InChIKey | QTBNLNCIMSCCQD-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.45 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|