C17H28IN5O2 — CID 111415664
1-ethyl-2-[(2-nitrophenyl)methyl]-3-(2-piperidin-1-ylethyl)guanidine;hydroiodide (PubChem CID 111415664) has the molecular formula C17H28IN5O2 and a molecular weight of 461.35 g/mol. Its IUPAC name is 1-ethyl-2-[(2-nitrophenyl)methyl]-3-(2-piperidin-1-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(2-nitrophenyl)methyl]-3-(2-piperidin-1-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111415664 |
| Molecular Formula | C17H28IN5O2 |
| Molecular Weight | 461.35 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | 1-ethyl-2-[(2-nitrophenyl)methyl]-3-(2-piperidin-1-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1[N+](=O)[O-])NCCN1CCCCC1.I |
| InChI | InChI=1S/C17H27N5O2.HI/c1-2-18-17(19-10-13-21-11-6-3-7-12-21)20-14-15-8-4-5-9-16(15)22(23)24;/h4-5,8-9H,2-3,6-7,10-14H2,1H3,(H2,18,19,20);1H |
| InChIKey | ZUFLMQAMONYVOF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 82.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.35 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|