C17H27N5O3 — CID 111941665
N,N-diethyl-3-[[N-ethyl-N'-[(2-nitrophenyl)methyl]carbamimidoyl]amino]propanamide (PubChem CID 111941665) has the molecular formula C17H27N5O3 and a molecular weight of 349.44 g/mol. Its IUPAC name is N,N-diethyl-3-[[N-ethyl-N'-[(2-nitrophenyl)methyl]carbamimidoyl]amino]propanamide.
| Compound Name | N,N-diethyl-3-[[N-ethyl-N'-[(2-nitrophenyl)methyl]carbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 111941665 |
| Molecular Formula | C17H27N5O3 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | N,N-diethyl-3-[[N-ethyl-N'-[(2-nitrophenyl)methyl]carbamimidoyl]amino]propanamide |
| SMILES | CCN/C(=N\Cc1ccccc1[N+](=O)[O-])NCCC(=O)N(CC)CC |
| InChI | InChI=1S/C17H27N5O3/c1-4-18-17(19-12-11-16(23)21(5-2)6-3)20-13-14-9-7-8-10-15(14)22(24)25/h7-10H,4-6,11-13H2,1-3H3,(H2,18,19,20) |
| InChIKey | BNLSBOWTACVBSF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|