C13H25IN6O — CID 111415810
2-methyl-1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-3-(2-piperidin-1-ylethyl)guanidine;hydroiodide (PubChem CID 111415810) has the molecular formula C13H25IN6O and a molecular weight of 408.29 g/mol. Its IUPAC name is 2-methyl-1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-3-(2-piperidin-1-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-3-(2-piperidin-1-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111415810 |
| Molecular Formula | C13H25IN6O |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 2-methyl-1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-3-(2-piperidin-1-ylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCN1CCCCC1)NCc1nc(C)no1.I |
| InChI | InChI=1S/C13H24N6O.HI/c1-11-17-12(20-18-11)10-16-13(14-2)15-6-9-19-7-4-3-5-8-19;/h3-10H2,1-2H3,(H2,14,15,16);1H |
| InChIKey | OUIXMZKQDSLSRC-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 78.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|