C21H27F3N4 — CID 111420287
1-[[2-[(dimethylamino)methyl]phenyl]methyl]-3-ethyl-2-[[4-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 111420287) has the molecular formula C21H27F3N4 and a molecular weight of 392.47 g/mol. Its IUPAC name is 1-[[2-[(dimethylamino)methyl]phenyl]methyl]-3-ethyl-2-[[4-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 1-[[2-[(dimethylamino)methyl]phenyl]methyl]-3-ethyl-2-[[4-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111420287 |
| Molecular Formula | C21H27F3N4 |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 1-[[2-[(dimethylamino)methyl]phenyl]methyl]-3-ethyl-2-[[4-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(C(F)(F)F)cc1)NCc1ccccc1CN(C)C |
| InChI | InChI=1S/C21H27F3N4/c1-4-25-20(26-13-16-9-11-19(12-10-16)21(22,23)24)27-14-17-7-5-6-8-18(17)15-28(2)3/h5-12H,4,13-15H2,1-3H3,(H2,25,26,27) |
| InChIKey | PJQDDHSGMGQXEW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|