C20H30F3N5O — CID 111420555
1-[4-[[N'-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]butyl]piperidine-4-carboxamide (PubChem CID 111420555) has the molecular formula C20H30F3N5O and a molecular weight of 413.49 g/mol. Its IUPAC name is 1-[4-[[N'-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]butyl]piperidine-4-carboxamide.
| Compound Name | 1-[4-[[N'-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]butyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 111420555 |
| Molecular Formula | C20H30F3N5O |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | 1-[4-[[N'-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]butyl]piperidine-4-carboxamide |
| SMILES | C/N=C(\NCCCCN1CCC(C(N)=O)CC1)NCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H30F3N5O/c1-25-19(27-14-15-4-6-17(7-5-15)20(21,22)23)26-10-2-3-11-28-12-8-16(9-13-28)18(24)29/h4-7,16H,2-3,8-14H2,1H3,(H2,24,29)(H2,25,26,27) |
| InChIKey | BJHUAXOJKFZREE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|