C14H25ClN4O — CID 111421651
1-[(5-chloro-3-ethyl-1-methylpyrazol-4-yl)methylamino]-3-pyrrolidin-1-ylpropan-2-ol (PubChem CID 111421651) has the molecular formula C14H25ClN4O and a molecular weight of 300.83 g/mol. Its IUPAC name is 1-[(5-chloro-3-ethyl-1-methylpyrazol-4-yl)methylamino]-3-pyrrolidin-1-ylpropan-2-ol.
| Compound Name | 1-[(5-chloro-3-ethyl-1-methylpyrazol-4-yl)methylamino]-3-pyrrolidin-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 111421651 |
| Molecular Formula | C14H25ClN4O |
| Molecular Weight | 300.83 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 1-[(5-chloro-3-ethyl-1-methylpyrazol-4-yl)methylamino]-3-pyrrolidin-1-ylpropan-2-ol |
| SMILES | CCc1nn(C)c(Cl)c1CNCC(O)CN1CCCC1 |
| InChI | InChI=1S/C14H25ClN4O/c1-3-13-12(14(15)18(2)17-13)9-16-8-11(20)10-19-6-4-5-7-19/h11,16,20H,3-10H2,1-2H3 |
| InChIKey | NNKBYGVVTAXJOY-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.83 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |