C8H13ClN2 — CID 142045538
5-chloro-3,4-diethyl-1-methylpyrazole (PubChem CID 142045538) has the molecular formula C8H13ClN2 and a molecular weight of 172.66 g/mol. Its IUPAC name is 5-chloro-3,4-diethyl-1-methylpyrazole.
| Compound Name | 5-chloro-3,4-diethyl-1-methylpyrazole |
|---|---|
| PubChem CID | 142045538 |
| Molecular Formula | C8H13ClN2 |
| Molecular Weight | 172.66 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | 5-chloro-3,4-diethyl-1-methylpyrazole |
| SMILES | CCc1nn(C)c(Cl)c1CC |
| InChI | InChI=1S/C8H13ClN2/c1-4-6-7(5-2)10-11(3)8(6)9/h4-5H2,1-3H3 |
| InChIKey | MMZVBRWZDPXMHU-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.66 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |