C17H32N4O2 — CID 111421990
3-methyl-1-[(1-methyl-5-morpholin-4-yl-3-propan-2-ylpyrazol-4-yl)methylamino]butan-2-ol (PubChem CID 111421990) has the molecular formula C17H32N4O2 and a molecular weight of 324.47 g/mol. Its IUPAC name is 3-methyl-1-[(1-methyl-5-morpholin-4-yl-3-propan-2-ylpyrazol-4-yl)methylamino]butan-2-ol.
| Compound Name | 3-methyl-1-[(1-methyl-5-morpholin-4-yl-3-propan-2-ylpyrazol-4-yl)methylamino]butan-2-ol |
|---|---|
| PubChem CID | 111421990 |
| Molecular Formula | C17H32N4O2 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | 3-methyl-1-[(1-methyl-5-morpholin-4-yl-3-propan-2-ylpyrazol-4-yl)methylamino]butan-2-ol |
| SMILES | CC(C)c1nn(C)c(N2CCOCC2)c1CNCC(O)C(C)C |
| InChI | InChI=1S/C17H32N4O2/c1-12(2)15(22)11-18-10-14-16(13(3)4)19-20(5)17(14)21-6-8-23-9-7-21/h12-13,15,18,22H,6-11H2,1-5H3 |
| InChIKey | HEQMNMCWRYVFFR-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |