C15H28N4O2 — CID 51104664
1-[(1-methyl-5-morpholin-4-yl-3-propan-2-ylpyrazol-4-yl)methylamino]propan-2-ol (PubChem CID 51104664) has the molecular formula C15H28N4O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is 1-[(1-methyl-5-morpholin-4-yl-3-propan-2-ylpyrazol-4-yl)methylamino]propan-2-ol.
| Compound Name | 1-[(1-methyl-5-morpholin-4-yl-3-propan-2-ylpyrazol-4-yl)methylamino]propan-2-ol |
|---|---|
| PubChem CID | 51104664 |
| Molecular Formula | C15H28N4O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | 1-[(1-methyl-5-morpholin-4-yl-3-propan-2-ylpyrazol-4-yl)methylamino]propan-2-ol |
| SMILES | CC(O)CNCc1c(C(C)C)nn(C)c1N1CCOCC1 |
| InChI | InChI=1S/C15H28N4O2/c1-11(2)14-13(10-16-9-12(3)20)15(18(4)17-14)19-5-7-21-8-6-19/h11-12,16,20H,5-10H2,1-4H3 |
| InChIKey | CANQBAZIJMXHNR-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |