C18H34N4O2 — CID 111448755
4-methyl-5-[(1-methyl-5-morpholin-4-yl-3-propan-2-ylpyrazol-4-yl)methylamino]pentan-2-ol (PubChem CID 111448755) has the molecular formula C18H34N4O2 and a molecular weight of 338.50 g/mol. Its IUPAC name is 4-methyl-5-[(1-methyl-5-morpholin-4-yl-3-propan-2-ylpyrazol-4-yl)methylamino]pentan-2-ol.
| Compound Name | 4-methyl-5-[(1-methyl-5-morpholin-4-yl-3-propan-2-ylpyrazol-4-yl)methylamino]pentan-2-ol |
|---|---|
| PubChem CID | 111448755 |
| Molecular Formula | C18H34N4O2 |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.27 |
| IUPAC Name | 4-methyl-5-[(1-methyl-5-morpholin-4-yl-3-propan-2-ylpyrazol-4-yl)methylamino]pentan-2-ol |
| SMILES | CC(O)CC(C)CNCc1c(C(C)C)nn(C)c1N1CCOCC1 |
| InChI | InChI=1S/C18H34N4O2/c1-13(2)17-16(12-19-11-14(3)10-15(4)23)18(21(5)20-17)22-6-8-24-9-7-22/h13-15,19,23H,6-12H2,1-5H3 |
| InChIKey | IDZJWWDLZMTPIK-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |