C15H18FN3O2 — CID 111423085
2-[[3-(3-fluoro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl-prop-2-enylamino]ethanol (PubChem CID 111423085) has the molecular formula C15H18FN3O2 and a molecular weight of 291.33 g/mol. Its IUPAC name is 2-[[3-(3-fluoro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl-prop-2-enylamino]ethanol.
| Compound Name | 2-[[3-(3-fluoro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl-prop-2-enylamino]ethanol |
|---|---|
| PubChem CID | 111423085 |
| Molecular Formula | C15H18FN3O2 |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 2-[[3-(3-fluoro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl-prop-2-enylamino]ethanol |
| SMILES | C=CCN(CCO)Cc1nc(-c2ccc(C)c(F)c2)no1 |
| InChI | InChI=1S/C15H18FN3O2/c1-3-6-19(7-8-20)10-14-17-15(18-21-14)12-5-4-11(2)13(16)9-12/h3-5,9,20H,1,6-8,10H2,2H3 |
| InChIKey | GLWKULXBORIDPI-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|