C15H22N2O2 — CID 111423290
3-[[2-hydroxyethyl(prop-2-enyl)amino]methyl]-N,N-dimethylbenzamide (PubChem CID 111423290) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 3-[[2-hydroxyethyl(prop-2-enyl)amino]methyl]-N,N-dimethylbenzamide.
| Compound Name | 3-[[2-hydroxyethyl(prop-2-enyl)amino]methyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 111423290 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 3-[[2-hydroxyethyl(prop-2-enyl)amino]methyl]-N,N-dimethylbenzamide |
| SMILES | C=CCN(CCO)Cc1cccc(C(=O)N(C)C)c1 |
| InChI | InChI=1S/C15H22N2O2/c1-4-8-17(9-10-18)12-13-6-5-7-14(11-13)15(19)16(2)3/h4-7,11,18H,1,8-10,12H2,2-3H3 |
| InChIKey | KUUJEDHNZAZZEN-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|