C17H23ClN2O2 — CID 111424309
3-[(4-chlorophenyl)-cyclobutylmethyl]-1-(2-hydroxyethyl)-1-prop-2-enylurea (PubChem CID 111424309) has the molecular formula C17H23ClN2O2 and a molecular weight of 322.84 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)-cyclobutylmethyl]-1-(2-hydroxyethyl)-1-prop-2-enylurea.
| Compound Name | 3-[(4-chlorophenyl)-cyclobutylmethyl]-1-(2-hydroxyethyl)-1-prop-2-enylurea |
|---|---|
| PubChem CID | 111424309 |
| Molecular Formula | C17H23ClN2O2 |
| Molecular Weight | 322.84 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 3-[(4-chlorophenyl)-cyclobutylmethyl]-1-(2-hydroxyethyl)-1-prop-2-enylurea |
| SMILES | C=CCN(CCO)C(=O)NC(c1ccc(Cl)cc1)C1CCC1 |
| InChI | InChI=1S/C17H23ClN2O2/c1-2-10-20(11-12-21)17(22)19-16(13-4-3-5-13)14-6-8-15(18)9-7-14/h2,6-9,13,16,21H,1,3-5,10-12H2,(H,19,22) |
| InChIKey | FLKBUMUBRTXAJM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.84 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|