C18H30O5Si — CID 11142780
methyl 3-[(1S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-oxo-8-oxabicyclo[3.2.1]oct-6-en-1-yl]propanoate (PubChem CID 11142780) has the molecular formula C18H30O5Si and a molecular weight of 354.52 g/mol. Its IUPAC name is methyl 3-[(1S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-oxo-8-oxabicyclo[3.2.1]oct-6-en-1-yl]propanoate.
| Compound Name | methyl 3-[(1S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-oxo-8-oxabicyclo[3.2.1]oct-6-en-1-yl]propanoate |
|---|---|
| PubChem CID | 11142780 |
| Molecular Formula | C18H30O5Si |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | methyl 3-[(1S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-oxo-8-oxabicyclo[3.2.1]oct-6-en-1-yl]propanoate |
| SMILES | COC(=O)CC[C@@]12C=C[C@@](CO[Si](C)(C)C(C)(C)C)(CC(=O)C1)O2 |
| InChI | InChI=1S/C18H30O5Si/c1-16(2,3)24(5,6)22-13-18-10-9-17(23-18,11-14(19)12-18)8-7-15(20)21-4/h9-10H,7-8,11-13H2,1-6H3/t17-,18+/m1/s1 |
| InChIKey | KQPHPLIROLLNLU-MSOLQXFVSA-N |
| XLogP | 3.39 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|