C16H23ClN2O2 — CID 111428345
N-[1-(2-chlorophenyl)-2-methylpropyl]-2-(hydroxymethyl)pyrrolidine-1-carboxamide (PubChem CID 111428345) has the molecular formula C16H23ClN2O2 and a molecular weight of 310.82 g/mol. Its IUPAC name is N-[1-(2-chlorophenyl)-2-methylpropyl]-2-(hydroxymethyl)pyrrolidine-1-carboxamide.
| Compound Name | N-[1-(2-chlorophenyl)-2-methylpropyl]-2-(hydroxymethyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 111428345 |
| Molecular Formula | C16H23ClN2O2 |
| Molecular Weight | 310.82 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | N-[1-(2-chlorophenyl)-2-methylpropyl]-2-(hydroxymethyl)pyrrolidine-1-carboxamide |
| SMILES | CC(C)C(NC(=O)N1CCCC1CO)c1ccccc1Cl |
| InChI | InChI=1S/C16H23ClN2O2/c1-11(2)15(13-7-3-4-8-14(13)17)18-16(21)19-9-5-6-12(19)10-20/h3-4,7-8,11-12,15,20H,5-6,9-10H2,1-2H3,(H,18,21) |
| InChIKey | XNPPWPYLUWPXCR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.82 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |