C14H17ClN2O4 — CID 126816599
methyl 2-chloro-6-[[(2S)-2-(hydroxymethyl)pyrrolidine-1-carbonyl]amino]benzoate (PubChem CID 126816599) has the molecular formula C14H17ClN2O4 and a molecular weight of 312.75 g/mol. Its IUPAC name is methyl 2-chloro-6-[[(2S)-2-(hydroxymethyl)pyrrolidine-1-carbonyl]amino]benzoate.
| Compound Name | methyl 2-chloro-6-[[(2S)-2-(hydroxymethyl)pyrrolidine-1-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 126816599 |
| Molecular Formula | C14H17ClN2O4 |
| Molecular Weight | 312.75 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | methyl 2-chloro-6-[[(2S)-2-(hydroxymethyl)pyrrolidine-1-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1c(Cl)cccc1NC(=O)N1CCC[C@H]1CO |
| InChI | InChI=1S/C14H17ClN2O4/c1-21-13(19)12-10(15)5-2-6-11(12)16-14(20)17-7-3-4-9(17)8-18/h2,5-6,9,18H,3-4,7-8H2,1H3,(H,16,20)/t9-/m0/s1 |
| InChIKey | DMFICMODWCFIFZ-VIFPVBQESA-N |
| XLogP | 2.12 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.75 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |