C12H12ClNO3 — CID 141100148
methyl 2-chloro-6-(cyclopropanecarbonylamino)benzoate (PubChem CID 141100148) has the molecular formula C12H12ClNO3 and a molecular weight of 253.68 g/mol. Its IUPAC name is methyl 2-chloro-6-(cyclopropanecarbonylamino)benzoate.
| Compound Name | methyl 2-chloro-6-(cyclopropanecarbonylamino)benzoate |
|---|---|
| PubChem CID | 141100148 |
| Molecular Formula | C12H12ClNO3 |
| Molecular Weight | 253.68 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | methyl 2-chloro-6-(cyclopropanecarbonylamino)benzoate |
| SMILES | COC(=O)c1c(Cl)cccc1NC(=O)C1CC1 |
| InChI | InChI=1S/C12H12ClNO3/c1-17-12(16)10-8(13)3-2-4-9(10)14-11(15)7-5-6-7/h2-4,7H,5-6H2,1H3,(H,14,15) |
| InChIKey | MGJRQMNLQIVLCE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.68 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |