C17H25ClN2O3 — CID 97436050
(2R)-N-(3-chloro-2-propan-2-yloxyphenyl)-2-(methoxymethyl)piperidine-1-carboxamide (PubChem CID 97436050) has the molecular formula C17H25ClN2O3 and a molecular weight of 340.85 g/mol. Its IUPAC name is (2R)-N-(3-chloro-2-propan-2-yloxyphenyl)-2-(methoxymethyl)piperidine-1-carboxamide.
| Compound Name | (2R)-N-(3-chloro-2-propan-2-yloxyphenyl)-2-(methoxymethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 97436050 |
| Molecular Formula | C17H25ClN2O3 |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | (2R)-N-(3-chloro-2-propan-2-yloxyphenyl)-2-(methoxymethyl)piperidine-1-carboxamide |
| SMILES | COC[C@H]1CCCCN1C(=O)Nc1cccc(Cl)c1OC(C)C |
| InChI | InChI=1S/C17H25ClN2O3/c1-12(2)23-16-14(18)8-6-9-15(16)19-17(21)20-10-5-4-7-13(20)11-22-3/h6,8-9,12-13H,4-5,7,10-11H2,1-3H3,(H,19,21)/t13-/m1/s1 |
| InChIKey | ITJSAKXQLVLIRP-CYBMUJFWSA-N |
| XLogP | 4.16 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |