C18H28N2O2S — CID 111429425
2-(2,5-dimethylphenyl)sulfanyl-N-[3-(4-hydroxypiperidin-1-yl)propyl]acetamide (PubChem CID 111429425) has the molecular formula C18H28N2O2S and a molecular weight of 336.50 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)sulfanyl-N-[3-(4-hydroxypiperidin-1-yl)propyl]acetamide.
| Compound Name | 2-(2,5-dimethylphenyl)sulfanyl-N-[3-(4-hydroxypiperidin-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 111429425 |
| Molecular Formula | C18H28N2O2S |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | 2-(2,5-dimethylphenyl)sulfanyl-N-[3-(4-hydroxypiperidin-1-yl)propyl]acetamide |
| SMILES | Cc1ccc(C)c(SCC(=O)NCCCN2CCC(O)CC2)c1 |
| InChI | InChI=1S/C18H28N2O2S/c1-14-4-5-15(2)17(12-14)23-13-18(22)19-8-3-9-20-10-6-16(21)7-11-20/h4-5,12,16,21H,3,6-11,13H2,1-2H3,(H,19,22) |
| InChIKey | PNWFMJKELPVVHE-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|