C18H20FNO3 — CID 111429882
[5-(4-fluorophenyl)furan-2-yl]-[4-(1-hydroxyethyl)piperidin-1-yl]methanone (PubChem CID 111429882) has the molecular formula C18H20FNO3 and a molecular weight of 317.36 g/mol. Its IUPAC name is [5-(4-fluorophenyl)furan-2-yl]-[4-(1-hydroxyethyl)piperidin-1-yl]methanone.
| Compound Name | [5-(4-fluorophenyl)furan-2-yl]-[4-(1-hydroxyethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 111429882 |
| Molecular Formula | C18H20FNO3 |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | [5-(4-fluorophenyl)furan-2-yl]-[4-(1-hydroxyethyl)piperidin-1-yl]methanone |
| SMILES | CC(O)C1CCN(C(=O)c2ccc(-c3ccc(F)cc3)o2)CC1 |
| InChI | InChI=1S/C18H20FNO3/c1-12(21)13-8-10-20(11-9-13)18(22)17-7-6-16(23-17)14-2-4-15(19)5-3-14/h2-7,12-13,21H,8-11H2,1H3 |
| InChIKey | IGXAXTYRSYKGLY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |