C15H14FNO3 — CID 111694888
[5-(4-fluorophenyl)furan-2-yl]-[(3S)-3-hydroxypyrrolidin-1-yl]methanone (PubChem CID 111694888) has the molecular formula C15H14FNO3 and a molecular weight of 275.28 g/mol. Its IUPAC name is [5-(4-fluorophenyl)furan-2-yl]-[(3S)-3-hydroxypyrrolidin-1-yl]methanone.
| Compound Name | [5-(4-fluorophenyl)furan-2-yl]-[(3S)-3-hydroxypyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 111694888 |
| Molecular Formula | C15H14FNO3 |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | [5-(4-fluorophenyl)furan-2-yl]-[(3S)-3-hydroxypyrrolidin-1-yl]methanone |
| SMILES | O=C(c1ccc(-c2ccc(F)cc2)o1)N1CC[C@H](O)C1 |
| InChI | InChI=1S/C15H14FNO3/c16-11-3-1-10(2-4-11)13-5-6-14(20-13)15(19)17-8-7-12(18)9-17/h1-6,12,18H,7-9H2/t12-/m0/s1 |
| InChIKey | IZIYUQLPVDQMOG-LBPRGKRZSA-N |
| XLogP | 2.29 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |