C17H16FNO4 — CID 119257310
1-[5-(4-fluorophenyl)furan-2-carbonyl]-3-methylpyrrolidine-3-carboxylic acid (PubChem CID 119257310) has the molecular formula C17H16FNO4 and a molecular weight of 317.32 g/mol. Its IUPAC name is 1-[5-(4-fluorophenyl)furan-2-carbonyl]-3-methylpyrrolidine-3-carboxylic acid.
| Compound Name | 1-[5-(4-fluorophenyl)furan-2-carbonyl]-3-methylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 119257310 |
| Molecular Formula | C17H16FNO4 |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 1-[5-(4-fluorophenyl)furan-2-carbonyl]-3-methylpyrrolidine-3-carboxylic acid |
| SMILES | CC1(C(=O)O)CCN(C(=O)c2ccc(-c3ccc(F)cc3)o2)C1 |
| InChI | InChI=1S/C17H16FNO4/c1-17(16(21)22)8-9-19(10-17)15(20)14-7-6-13(23-14)11-2-4-12(18)5-3-11/h2-7H,8-10H2,1H3,(H,21,22) |
| InChIKey | CLEAIGUJIHZAFG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |