C15H19ClN2O4 — CID 111430478
N-[(2-chloro-5-nitrophenyl)methyl]-2-(1-hydroxycyclopentyl)-N-methylacetamide (PubChem CID 111430478) has the molecular formula C15H19ClN2O4 and a molecular weight of 326.78 g/mol. Its IUPAC name is N-[(2-chloro-5-nitrophenyl)methyl]-2-(1-hydroxycyclopentyl)-N-methylacetamide.
| Compound Name | N-[(2-chloro-5-nitrophenyl)methyl]-2-(1-hydroxycyclopentyl)-N-methylacetamide |
|---|---|
| PubChem CID | 111430478 |
| Molecular Formula | C15H19ClN2O4 |
| Molecular Weight | 326.78 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | N-[(2-chloro-5-nitrophenyl)methyl]-2-(1-hydroxycyclopentyl)-N-methylacetamide |
| SMILES | CN(Cc1cc([N+](=O)[O-])ccc1Cl)C(=O)CC1(O)CCCC1 |
| InChI | InChI=1S/C15H19ClN2O4/c1-17(14(19)9-15(20)6-2-3-7-15)10-11-8-12(18(21)22)4-5-13(11)16/h4-5,8,20H,2-3,6-7,9-10H2,1H3 |
| InChIKey | OCOOESALLRKGAF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.78 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|