C15H19ClFN3OS — CID 111432053
2-[(5-chlorothiadiazol-4-yl)methyl-(2-methylpropyl)amino]-1-(4-fluorophenyl)ethanol (PubChem CID 111432053) has the molecular formula C15H19ClFN3OS and a molecular weight of 343.86 g/mol. Its IUPAC name is 2-[(5-chlorothiadiazol-4-yl)methyl-(2-methylpropyl)amino]-1-(4-fluorophenyl)ethanol.
| Compound Name | 2-[(5-chlorothiadiazol-4-yl)methyl-(2-methylpropyl)amino]-1-(4-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 111432053 |
| Molecular Formula | C15H19ClFN3OS |
| Molecular Weight | 343.86 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 2-[(5-chlorothiadiazol-4-yl)methyl-(2-methylpropyl)amino]-1-(4-fluorophenyl)ethanol |
| SMILES | CC(C)CN(Cc1nnsc1Cl)CC(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H19ClFN3OS/c1-10(2)7-20(8-13-15(16)22-19-18-13)9-14(21)11-3-5-12(17)6-4-11/h3-6,10,14,21H,7-9H2,1-2H3 |
| InChIKey | HGBHMRBSNRKONZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.86 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |