C16H21F2NO2 — CID 111432741
N-[1-(3,4-difluorophenyl)ethyl]-2-(1-hydroxycyclohexyl)acetamide (PubChem CID 111432741) has the molecular formula C16H21F2NO2 and a molecular weight of 297.35 g/mol. Its IUPAC name is N-[1-(3,4-difluorophenyl)ethyl]-2-(1-hydroxycyclohexyl)acetamide.
| Compound Name | N-[1-(3,4-difluorophenyl)ethyl]-2-(1-hydroxycyclohexyl)acetamide |
|---|---|
| PubChem CID | 111432741 |
| Molecular Formula | C16H21F2NO2 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-[1-(3,4-difluorophenyl)ethyl]-2-(1-hydroxycyclohexyl)acetamide |
| SMILES | CC(NC(=O)CC1(O)CCCCC1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H21F2NO2/c1-11(12-5-6-13(17)14(18)9-12)19-15(20)10-16(21)7-3-2-4-8-16/h5-6,9,11,21H,2-4,7-8,10H2,1H3,(H,19,20) |
| InChIKey | GQLGIXKSUZSKLT-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |