C17H24FNO2 — CID 111433244
2-(2-fluorophenyl)-N-[(1-hydroxycycloheptyl)methyl]propanamide (PubChem CID 111433244) has the molecular formula C17H24FNO2 and a molecular weight of 293.38 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-N-[(1-hydroxycycloheptyl)methyl]propanamide.
| Compound Name | 2-(2-fluorophenyl)-N-[(1-hydroxycycloheptyl)methyl]propanamide |
|---|---|
| PubChem CID | 111433244 |
| Molecular Formula | C17H24FNO2 |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | 2-(2-fluorophenyl)-N-[(1-hydroxycycloheptyl)methyl]propanamide |
| SMILES | CC(C(=O)NCC1(O)CCCCCC1)c1ccccc1F |
| InChI | InChI=1S/C17H24FNO2/c1-13(14-8-4-5-9-15(14)18)16(20)19-12-17(21)10-6-2-3-7-11-17/h4-5,8-9,13,21H,2-3,6-7,10-12H2,1H3,(H,19,20) |
| InChIKey | DYNYAMTZFXGLPI-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |