C19H25FN4O2 — CID 125441973
1-[(1S)-1-[1-(2-fluorophenyl)pyrazol-4-yl]ethyl]-3-[(1-hydroxycyclohexyl)methyl]urea (PubChem CID 125441973) has the molecular formula C19H25FN4O2 and a molecular weight of 360.43 g/mol. Its IUPAC name is 1-[(1S)-1-[1-(2-fluorophenyl)pyrazol-4-yl]ethyl]-3-[(1-hydroxycyclohexyl)methyl]urea.
| Compound Name | 1-[(1S)-1-[1-(2-fluorophenyl)pyrazol-4-yl]ethyl]-3-[(1-hydroxycyclohexyl)methyl]urea |
|---|---|
| PubChem CID | 125441973 |
| Molecular Formula | C19H25FN4O2 |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 1-[(1S)-1-[1-(2-fluorophenyl)pyrazol-4-yl]ethyl]-3-[(1-hydroxycyclohexyl)methyl]urea |
| SMILES | C[C@H](NC(=O)NCC1(O)CCCCC1)c1cnn(-c2ccccc2F)c1 |
| InChI | InChI=1S/C19H25FN4O2/c1-14(23-18(25)21-13-19(26)9-5-2-6-10-19)15-11-22-24(12-15)17-8-4-3-7-16(17)20/h3-4,7-8,11-12,14,26H,2,5-6,9-10,13H2,1H3,(H2,21,23,25)/t14-/m0/s1 |
| InChIKey | SYNSLLRZIHUCKV-AWEZNQCLSA-N |
| XLogP | 3.07 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |