C20H28N4O3 — CID 125445589
1-[(1-hydroxycyclohexyl)methyl]-3-[(1R)-1-[1-(2-methoxyphenyl)pyrazol-4-yl]ethyl]urea (PubChem CID 125445589) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is 1-[(1-hydroxycyclohexyl)methyl]-3-[(1R)-1-[1-(2-methoxyphenyl)pyrazol-4-yl]ethyl]urea.
| Compound Name | 1-[(1-hydroxycyclohexyl)methyl]-3-[(1R)-1-[1-(2-methoxyphenyl)pyrazol-4-yl]ethyl]urea |
|---|---|
| PubChem CID | 125445589 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | 1-[(1-hydroxycyclohexyl)methyl]-3-[(1R)-1-[1-(2-methoxyphenyl)pyrazol-4-yl]ethyl]urea |
| SMILES | COc1ccccc1-n1cc([C@@H](C)NC(=O)NCC2(O)CCCCC2)cn1 |
| InChI | InChI=1S/C20H28N4O3/c1-15(23-19(25)21-14-20(26)10-6-3-7-11-20)16-12-22-24(13-16)17-8-4-5-9-18(17)27-2/h4-5,8-9,12-13,15,26H,3,6-7,10-11,14H2,1-2H3,(H2,21,23,25)/t15-/m1/s1 |
| InChIKey | UYKMXLYBEQVBGD-OAHLLOKOSA-N |
| XLogP | 2.94 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |