C21H31N5O2 — CID 125444228
1-(1-ethylpiperidin-4-yl)-3-[(1S)-1-[1-(2-methoxyphenyl)pyrazol-4-yl]ethyl]-1-methylurea (PubChem CID 125444228) has the molecular formula C21H31N5O2 and a molecular weight of 385.51 g/mol. Its IUPAC name is 1-(1-ethylpiperidin-4-yl)-3-[(1S)-1-[1-(2-methoxyphenyl)pyrazol-4-yl]ethyl]-1-methylurea.
| Compound Name | 1-(1-ethylpiperidin-4-yl)-3-[(1S)-1-[1-(2-methoxyphenyl)pyrazol-4-yl]ethyl]-1-methylurea |
|---|---|
| PubChem CID | 125444228 |
| Molecular Formula | C21H31N5O2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.25 |
| IUPAC Name | 1-(1-ethylpiperidin-4-yl)-3-[(1S)-1-[1-(2-methoxyphenyl)pyrazol-4-yl]ethyl]-1-methylurea |
| SMILES | CCN1CCC(N(C)C(=O)N[C@@H](C)c2cnn(-c3ccccc3OC)c2)CC1 |
| InChI | InChI=1S/C21H31N5O2/c1-5-25-12-10-18(11-13-25)24(3)21(27)23-16(2)17-14-22-26(15-17)19-8-6-7-9-20(19)28-4/h6-9,14-16,18H,5,10-13H2,1-4H3,(H,23,27)/t16-/m0/s1 |
| InChIKey | WDCFKDJMSDETRG-INIZCTEOSA-N |
| XLogP | 3.07 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |