About 3-(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)-N-(3-hydroxybutyl)propanamide
3-(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)-N-(3-hydroxybutyl)propanamide (PubChem CID 111433631) has the molecular formula C12H20N2O3S
and a molecular weight of 272.37 g/mol. Its IUPAC name is 3-(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)-N-(3-hydroxybutyl)propanamide.
Molecular Properties
| Compound Name | 3-(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)-N-(3-hydroxybutyl)propanamide |
| PubChem CID | 111433631 |
| Molecular Formula | C12H20N2O3S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 3-(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)-N-(3-hydroxybutyl)propanamide |
| SMILES | Cc1sc(=O)n(CCC(=O)NCCC(C)O)c1C |
| InChI | InChI=1S/C12H20N2O3S/c1-8(15)4-6-13-11(16)5-7-14-9(2)10(3)18-12(14)17/h8,15H,4-7H2,1-3H3,(H,13,16) |
| InChIKey | BCBYEOSYHVQMKG-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)-N-(3-hydroxybutyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)-N-(3-hydroxybutyl)propanamide?
The IUPAC name of 3-(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)-N-(3-hydroxybutyl)propanamide (CID 111433631) is 3-(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)-N-(3-hydroxybutyl)propanamide.
What is the SMILES notation for 3-(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)-N-(3-hydroxybutyl)propanamide?
The canonical SMILES for 3-(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)-N-(3-hydroxybutyl)propanamide is Cc1sc(=O)n(CCC(=O)NCCC(C)O)c1C.
What is the InChIKey of 3-(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)-N-(3-hydroxybutyl)propanamide?
The InChIKey is BCBYEOSYHVQMKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O3S/c1-8(15)4-6-13-11(16)5-7-14-9(2)10(3)18-12(14)17/h8,15H,4-7H2,1-3H3,(H,13,16).
What are the key properties of 3-(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)-N-(3-hydroxybutyl)propanamide?
3-(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)-N-(3-hydroxybutyl)propanamide has a molecular weight of 272.37 g/mol, XLogP of 0.80, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)-N-(3-hydroxybutyl)propanamide is sourced from PubChem (CID 111433631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).