About 3-(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)-N-[3-(methylamino)propyl]propanamide
3-(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)-N-[3-(methylamino)propyl]propanamide (PubChem CID 119430533) has the molecular formula C12H21N3O2S
and a molecular weight of 271.39 g/mol. Its IUPAC name is 3-(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)-N-[3-(methylamino)propyl]propanamide.
Molecular Properties
| Compound Name | 3-(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)-N-[3-(methylamino)propyl]propanamide |
| PubChem CID | 119430533 |
| Molecular Formula | C12H21N3O2S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 3-(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)-N-[3-(methylamino)propyl]propanamide |
| SMILES | CNCCCNC(=O)CCn1c(C)c(C)sc1=O |
| InChI | InChI=1S/C12H21N3O2S/c1-9-10(2)18-12(17)15(9)8-5-11(16)14-7-4-6-13-3/h13H,4-8H2,1-3H3,(H,14,16) |
| InChIKey | VXJWMBGPFFDMPS-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)-N-[3-(methylamino)propyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)-N-[3-(methylamino)propyl]propanamide?
The IUPAC name of 3-(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)-N-[3-(methylamino)propyl]propanamide (CID 119430533) is 3-(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)-N-[3-(methylamino)propyl]propanamide.
What is the SMILES notation for 3-(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)-N-[3-(methylamino)propyl]propanamide?
The canonical SMILES for 3-(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)-N-[3-(methylamino)propyl]propanamide is CNCCCNC(=O)CCn1c(C)c(C)sc1=O.
What is the InChIKey of 3-(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)-N-[3-(methylamino)propyl]propanamide?
The InChIKey is VXJWMBGPFFDMPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3O2S/c1-9-10(2)18-12(17)15(9)8-5-11(16)14-7-4-6-13-3/h13H,4-8H2,1-3H3,(H,14,16).
What are the key properties of 3-(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)-N-[3-(methylamino)propyl]propanamide?
3-(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)-N-[3-(methylamino)propyl]propanamide has a molecular weight of 271.39 g/mol, XLogP of 0.64, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,5-dimethyl-2-oxo-1,3-thiazol-3-yl)-N-[3-(methylamino)propyl]propanamide is sourced from PubChem (CID 119430533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).