C10H16N2O2S — CID 111433740
2-ethyl-N-(3-hydroxybutyl)-1,3-thiazole-5-carboxamide (PubChem CID 111433740) has the molecular formula C10H16N2O2S and a molecular weight of 228.32 g/mol. Its IUPAC name is 2-ethyl-N-(3-hydroxybutyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-ethyl-N-(3-hydroxybutyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 111433740 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 2-ethyl-N-(3-hydroxybutyl)-1,3-thiazole-5-carboxamide |
| SMILES | CCc1ncc(C(=O)NCCC(C)O)s1 |
| InChI | InChI=1S/C10H16N2O2S/c1-3-9-12-6-8(15-9)10(14)11-5-4-7(2)13/h6-7,13H,3-5H2,1-2H3,(H,11,14) |
| InChIKey | FELHZGNLIHURSN-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |