C18H24F2N2O2 — CID 111433991
2-(2,4-difluorophenyl)-N-[3-(4-hydroxypiperidin-1-yl)propyl]cyclopropane-1-carboxamide (PubChem CID 111433991) has the molecular formula C18H24F2N2O2 and a molecular weight of 338.40 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-N-[3-(4-hydroxypiperidin-1-yl)propyl]cyclopropane-1-carboxamide.
| Compound Name | 2-(2,4-difluorophenyl)-N-[3-(4-hydroxypiperidin-1-yl)propyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 111433991 |
| Molecular Formula | C18H24F2N2O2 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 2-(2,4-difluorophenyl)-N-[3-(4-hydroxypiperidin-1-yl)propyl]cyclopropane-1-carboxamide |
| SMILES | O=C(NCCCN1CCC(O)CC1)C1CC1c1ccc(F)cc1F |
| InChI | InChI=1S/C18H24F2N2O2/c19-12-2-3-14(17(20)10-12)15-11-16(15)18(24)21-6-1-7-22-8-4-13(23)5-9-22/h2-3,10,13,15-16,23H,1,4-9,11H2,(H,21,24) |
| InChIKey | IPEIZKZYAIAVJE-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|