C14H18F2N2O3S — CID 96533325
cis-(1S,2R)-2-(2,4-difluorophenyl)-N-[3-(methanesulfonamido)propyl]cyclopropane-1-carboxamide (PubChem CID 96533325) has the molecular formula C14H18F2N2O3S and a molecular weight of 332.37 g/mol. Its IUPAC name is cis-(1S,2R)-2-(2,4-difluorophenyl)-N-[3-(methanesulfonamido)propyl]cyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2R)-2-(2,4-difluorophenyl)-N-[3-(methanesulfonamido)propyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 96533325 |
| Molecular Formula | C14H18F2N2O3S |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | cis-(1S,2R)-2-(2,4-difluorophenyl)-N-[3-(methanesulfonamido)propyl]cyclopropane-1-carboxamide |
| SMILES | CS(=O)(=O)NCCCNC(=O)[C@H]1C[C@H]1c1ccc(F)cc1F |
| InChI | InChI=1S/C14H18F2N2O3S/c1-22(20,21)18-6-2-5-17-14(19)12-8-11(12)10-4-3-9(15)7-13(10)16/h3-4,7,11-12,18H,2,5-6,8H2,1H3,(H,17,19)/t11-,12-/m0/s1 |
| InChIKey | JMVMPIVJWKPGDI-RYUDHWBXSA-N |
| XLogP | 1.12 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|