C16H32O6P2 — CID 11143434
4,4-bis(diethoxyphosphoryl)-1,2-dimethylcyclohexene (PubChem CID 11143434) has the molecular formula C16H32O6P2 and a molecular weight of 382.37 g/mol. Its IUPAC name is 4,4-bis(diethoxyphosphoryl)-1,2-dimethylcyclohexene.
| Compound Name | 4,4-bis(diethoxyphosphoryl)-1,2-dimethylcyclohexene |
|---|---|
| PubChem CID | 11143434 |
| Molecular Formula | C16H32O6P2 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 4,4-bis(diethoxyphosphoryl)-1,2-dimethylcyclohexene |
| SMILES | CCOP(=O)(OCC)C1(P(=O)(OCC)OCC)CCC(C)=C(C)C1 |
| InChI | InChI=1S/C16H32O6P2/c1-7-19-23(17,20-8-2)16(12-11-14(5)15(6)13-16)24(18,21-9-3)22-10-4/h7-13H2,1-6H3 |
| InChIKey | HSZUZBUHVQXKKH-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|