C18H38O6P2 — CID 134929354
(E)-1,1-bis(diethoxyphosphoryl)-2,3-dimethyloct-2-ene (PubChem CID 134929354) has the molecular formula C18H38O6P2 and a molecular weight of 412.44 g/mol. Its IUPAC name is (E)-1,1-bis(diethoxyphosphoryl)-2,3-dimethyloct-2-ene.
| Compound Name | (E)-1,1-bis(diethoxyphosphoryl)-2,3-dimethyloct-2-ene |
|---|---|
| PubChem CID | 134929354 |
| Molecular Formula | C18H38O6P2 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | (E)-1,1-bis(diethoxyphosphoryl)-2,3-dimethyloct-2-ene |
| SMILES | CCCCC/C(C)=C(\C)C(P(=O)(OCC)OCC)P(=O)(OCC)OCC |
| InChI | InChI=1S/C18H38O6P2/c1-8-13-14-15-16(6)17(7)18(25(19,21-9-2)22-10-3)26(20,23-11-4)24-12-5/h18H,8-15H2,1-7H3/b17-16+ |
| InChIKey | CNUSBVYALJZAHD-WUKNDPDISA-N |
| XLogP | 6.76 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|